2-n-Butoxyethyl Methacrylate (BEM) CAS#13532-94-0
2-n-Butoxyethyl methacrylate (BEM for short, CAS No. 13532-94-0) is a specialty acrylic monomer. Its butoxyethyl group gives polymer formulations better flexibility, weather resistance, and water repellency. That's why it's widely used in protective coatings, industrial resins, and adhesives.
Chemical Properties
| English Name | 2-N-BUTOXYETHYL METHACRYLATE |
| English Synonyms | 2-Butoxyethylmethacrylate;2-Propenoicacid,2-methyl-,2-butoxyethylester;2-N-BUTOXYETHYL METHACRYL ATE;N-BUTOXY ETHYL METHACRYLATE;2-n-Butoxyethyl methacrylate 13532-94-0;Ethylene glycol butyl ether methacrylate;Methacrylic acid (3-oxaheptan-1-yl) ester;Methacrylic acid 2-butoxyethyl ester |
| CAS Number | 13532-94-0 |
| Molecular Formula | C10H1803 |
| Molecular Weight | 186.25 |
| EINECS Number | 236-885-7 |
| Melting point | 90~92℃/3mm |
| Boiling point | 90-92°C 3mm |
| Density | 0.939 g/mL at 25 °C(lit.) |
| Vapor pressure | 99Pa at 20℃ |
| Refractive index | n20/D 1.4335(lit.) |
| Flash point | 93℃ |
| Water solubility | 1.007g/L at 25℃ |
| InChI | InChI=1S/C10H1803/c1-4-5-6-12-7-8-13-10(11)9(2)3/h2,4-8H2,1,3H3 |
| InChIKey | DJKKWVGWYCKUFC-UHFFFAOYSA-N |
| Smiles | C(OCCOCCCC)(=O)C(C)=C |
| LogP | 2.47 at 25℃ |
Product Applications
1. Functional monomer for acrylic polymers, enhancing coating flexibility and weather resistance.
2. Key raw material for high-performance adhesives and pressure-sensitive formulations.
3. Used in resin modification for inks, textile finishing agents and plastic additives.
4. Applied in water-based coating systems to optimize film-forming performance.
